Jump to:
loading...| Preferred Name |
phosphorous acid |
|
| Synonyms |
|
|
| Definitions |
A phosphorus oxoacid that has formula H3O3P. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36361 |
|
| alternative term |
P(OH)3 trioxophosphoric(3-) acid InChI=1S/H3O3P/c1-4(2)3/h1-3H [P(OH)3] InChIKey=OJMIONKXNSYLSR-UHFFFAOYSA-N [H]OP(O[H])O[H] H3O3P phosphorous acid H3PO3 phosphorige Saeure trihydroxidophosphorus trihydrogen trioxophosphate(3-) |
|
| definition |
A phosphorus oxoacid that has formula H3O3P. |
|
| is conjugate acid of | ||
| is tautomer of | ||
| label |
phosphorous acid |
|
| prefixIRI |
CHEBI:36361 |
|
| prefLabel |
phosphorous acid |
|
| subClassOf |
Create mapping