Jump to:
loading...| Preferred Name |
sorbic acid |
|
| Synonyms |
|
|
| Definitions |
A hexadienoic acid with double bonds at C-2 and C-4; has four geometrical isomers, of which the trans,trans-form is naturally occurring. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35962 |
|
| alternative term |
C6H8O2 crotylidene acetic acid hexa-2,4-dienoic acid 2,4-SA SA InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8) Sorbinsaeure [H]C(C)=CC([H])=CC(O)=O InChIKey=WSWCOQWTEOXDQX-UHFFFAOYSA-N 2-propenylacrylic acid (2-butenylidene) acetic acid 2,4-Hexadiensaeure 2,4-hexadienoic acid |
|
| definition |
A hexadienoic acid with double bonds at C-2 and C-4; has four geometrical isomers, of which the trans,trans-form is naturally occurring. |
|
| is conjugate acid of | ||
| label |
sorbic acid |
|
| prefixIRI |
CHEBI:35962 |
|
| prefLabel |
sorbic acid |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26208 |
Create mapping