Jump to:
loading...| Preferred Name |
isoprene |
|
| Synonyms |
|
|
| Definitions |
A hemiterpene with the formula CH2=C(CH3)CH=CH2; the monomer of natural rubber and a common structure motif to the isoprenoids, a large class of other naturally occurring compounds. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35194 |
|
| alternative term |
beta-methylbivinyl 2-methyldivinyl 2-methyl-1,3-butadiene CC(=C)C=C 2-methylbutadiene InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 isopentadiene 2-methylbuta-1,3-diene isoprene isoterpene Isopren isopreno C5H8 CH2=C(CH3)CH=CH2 InChIKey=RRHGJUQNOFWUDK-UHFFFAOYSA-N |
|
| definition |
A hemiterpene with the formula CH2=C(CH3)CH=CH2; the monomer of natural rubber and a common structure motif to the isoprenoids, a large class of other naturally occurring compounds. |
|
| label |
isoprene |
|
| prefixIRI |
CHEBI:35194 |
|
| prefLabel |
isoprene |
|
| subClassOf |
Create mapping