loading...| Preferred Name |
methyl methacrylate |
|
| Synonyms |
|
|
| Definitions |
An enoate ester compound having methacrylic acid as the carboxylic acid component and methanol as the alcohol component. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34840 |
|
| alternative term |
Methyl methacrylate Methyl-methacrylat Methyl 2-methyl-2-propenoate Methyl alpha-methylacrylate InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3 2-(Methoxycarbonyl)-1-propene Methacrylic acid methyl ester MMA 2-Methyl-2-propenoic acid methyl ester 2-Methylacrylic acid methyl ester Methyl 2-methylpropenoate Methyl methylacrylate COC(=O)C(C)=C Methyl 2-methylacrylate Methacrylate de methyle Methylmethacrylate InChIKey=VVQNEPGJFQJSBK-UHFFFAOYSA-N Methacrylsaeuremethyl ester C5H8O2 |
|
| definition |
An enoate ester compound having methacrylic acid as the carboxylic acid component and methanol as the alcohol component. |
|
| label |
methyl methacrylate |
|
| prefixIRI |
CHEBI:34840 |
|
| prefLabel |
methyl methacrylate |
|
| subClassOf |