Jump to:
loading...| Preferred Name |
glycyrrhetinic acid |
|
| Synonyms |
|
|
| Definitions |
A pentacyclic triterpenoid that has formula C30H46O4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30853 |
|
| alternative term |
Glycyrrhetinic acid 3beta-hydroxy-11-oxoolean-12-en-30-oic acid InChI=1S/C30H46O4/c1-25(2)21-8-11-30(7)23(28(21,5)10-9-22(25)32)20(31)16-18-19-17-27(4,24(33)34)13-12-26(19,3)14-15-29(18,30)6/h16,19,21-23,32H,8-15,17H2,1-7H3,(H,33,34)/t19-,21-,22-,23+,26+,27-,28-,29+,30+/m0/s1 18beta-glycyrrhetic acid C30H46O4 [H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]1(C)C2=CC(=O)[C@]2([H])[C@@]3(C)CC[C@H](O)C(C)(C)[C@]3([H])CC[C@@]12C)C(O)=O InChIKey=MPDGHEJMBKOTSU-YKLVYJNSSA-N Enoxolone |
|
| definition |
A pentacyclic triterpenoid that has formula C30H46O4. |
|
| has parent hydride | ||
| is conjugate acid of | ||
| label |
glycyrrhetinic acid |
|
| prefixIRI |
CHEBI:30853 |
|
| prefLabel |
glycyrrhetinic acid |
|
| subClassOf |
Create mapping