Preferred Name |
oleate |
|
Synonyms |
|
|
Definitions |
A C18, long straight-chain monounsaturated fatty acid anion; and the conjugate base of oleic acid, arising from deprotonation of the carboxylic acid group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30823 |
|
alternative term |
(Z)-9-octadecenoic acid, ion(1-) Oleat oleic acid anion cis-9-octadecenoate CCCCCCCCC=C/CCCCCCCC([O-])=O oleate C18H33O2 (9Z)-octadec-9-enoate InChIKey=ZQPPMHVWECSIRJ-KTKRTIGZSA-M InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/p-1/b10-9- |
|
definition |
A C18, long straight-chain monounsaturated fatty acid anion; and the conjugate base of oleic acid, arising from deprotonation of the carboxylic acid group. |
|
is conjugate base of | ||
label |
oleate |
|
prefixIRI |
CHEBI:30823 |
|
prefLabel |
oleate |
|
subClassOf |
Create mapping