Preferred Name |
gallic acid |
|
Synonyms |
|
|
Definitions |
A trihydroxybenzoic acid that has formula C7H6O5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30778 |
|
alternative term |
Pyrogallol-5-carboxylic acid OC(=O)c1cc(O)c(O)c(O)c1 Gallic acid 3,4,5-Trihydroxybenzoic acid InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12) C7H6O5 3,4,5-trihydroxybenzoic acid InChIKey=LNTHITQWFMADLM-UHFFFAOYSA-N |
|
definition |
A trihydroxybenzoic acid that has formula C7H6O5. |
|
is conjugate acid of | ||
label |
gallic acid |
|
prefixIRI |
CHEBI:30778 |
|
prefLabel |
gallic acid |
|
subClassOf |
Create mapping