Jump to:
loading...| Preferred Name |
glycolate |
|
| Synonyms |
|
|
| Definitions |
A hydroxy monocarboxylic acid anion that has formula C2H3O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29805 |
|
| alternative term |
C2H3O3 InChIKey=AEMRFAOFKBGASW-UHFFFAOYSA-M hydroxyacetate InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/p-1 OCC([O-])=O |
|
| definition |
A hydroxy monocarboxylic acid anion that has formula C2H3O3. |
|
| has functional parent | ||
| is conjugate base of | ||
| label |
glycolate |
|
| prefixIRI |
CHEBI:29805 |
|
| prefLabel |
glycolate |
|
| subClassOf |
Create mapping