Preferred Name |
serotonin |
|
Synonyms |
|
|
Definitions |
The 5-hydroxy derivative of tryptamine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28790 |
|
alternative term |
thrombocytin 5-HT C10H12N2O serotonine 3-(2-Aminoethyl)-1H-indol-5-ol SEROTONIN InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-N Serotonin thrombotonin 3-(2-aminoethyl)-1H-indol-5-ol InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 5-Hydroxytryptamine NCCc1c[nH]c2ccc(O)cc12 Enteramine |
|
definition |
The 5-hydroxy derivative of tryptamine. |
|
has functional parent | ||
has role | ||
is conjugate base of | ||
label |
serotonin |
|
prefixIRI |
CHEBI:28790 |
|
prefLabel |
serotonin |
|
subClassOf |
Create mapping