Preferred Name |
caffeine |
|
Synonyms |
|
|
Definitions |
A trimethylxanthine that has formula C8H10N4O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27732 |
|
alternative term |
InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 1-methyltheobromine cafeina InChIKey=RYYVLZVUVIJVGH-UHFFFAOYSA-N 1,3,7-trimethyl-2,6-dioxopurine CAFFEINE mateina anhydrous caffeine teina guaranine 3,7-Dihydro-1,3,7-trimethyl-1H-purin-2,6-dion 7-methyltheophylline Thein C8H10N4O2 1,3,7-trimethylpurine-2,6-dione Coffein theine methyltheobromine Koffein 1,3,7-trimethylxanthine cafeine Caffeine 1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione Cn1cnc2n(C)c(=O)n(C)c(=O)c12 |
|
definition |
A trimethylxanthine that has formula C8H10N4O2. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35337 |
|
label |
caffeine |
|
prefixIRI |
CHEBI:27732 |
|
prefLabel |
caffeine |
|
subClassOf |
Create mapping