Preferred Name |
thymol |
|
Synonyms |
|
|
Definitions |
A phenol that is a natural monoterpene derivative of cymene. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27607 |
|
alternative term |
5-methyl-2-isopropylphenol 6-isopropyl-3-methylphenol 6-isopropyl-m-cresol InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)6-10(9)11/h4-7,11H,1-3H3 CC(C)c1ccc(C)cc1O 3-p-cymenol 1-hydroxy-5-methyl-2-isopropylbenzene Thymol InChIKey=MGSRCZKZVOBKFT-UHFFFAOYSA-N C10H14O 5-methyl-2-(propan-2-yl)phenol 5-METHYL-2-(1-METHYLETHYL)PHENOL 2-isopropyl-5-methylphenol |
|
definition |
A phenol that is a natural monoterpene derivative of cymene. |
|
has parent hydride | ||
has role | ||
label |
thymol |
|
prefixIRI |
CHEBI:27607 |
|
prefLabel |
thymol |
|
subClassOf |
Create mapping