Preferred Name |
amantadine hydrochloride |
|
Synonyms |
|
|
Definitions |
A hydrochloride that has formula C10H18ClN. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2619 |
|
alternative term |
C10H17N.HCl InChIKey=WOLHOYHSEKDWQH-UHFFFAOYSA-N Symmetrel 1-Adamantanamine hydrochloride 1-Adamantylamine hydrochloride C10H18ClN 1-Aminoadamantene hydrochlorid tricyclo[3.3.1.1(3,7)]decan-1-aminium chloride adamantan-1-aminium chloride [Cl-].[NH3+]C12CC3CC(CC(C3)C1)C2 InChI=1S/C10H17N.ClH/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6,11H2;1H 1-Aminoadamantane hydrochloride Amantadine hydrochloride |
|
definition |
A hydrochloride that has formula C10H18ClN. |
|
has part | ||
label |
amantadine hydrochloride |
|
prefixIRI |
CHEBI:2619 |
|
prefLabel |
amantadine hydrochloride |
|
subClassOf |
Create mapping