Jump to:
loading...| Preferred Name |
methacrylic acid |
|
| Synonyms |
|
|
| Definitions |
A monocarboxylic acid that is acrylic acid in which the hydrogen at position 2 is substituted by a methyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25219 |
|
| alternative term |
2-Methylpropensaeure alpha-methacrylic acid InChIKey=CERQOIWHTDAKMF-UHFFFAOYSA-N 2-methyl-2-propenoic acid 2-methylprop-2-enoic acid Methakrylsaeure methacrylic acid C4H6O2 Methacrylsaeure 2-methylpropenoic acid InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6) 2-methylacrylic acid alpha-methylacrylic acid CC(=C)C(O)=O methylacrylic acid 2-methylenepropionic acid |
|
| definition |
A monocarboxylic acid that is acrylic acid in which the hydrogen at position 2 is substituted by a methyl group. |
|
| has functional parent | ||
| is conjugate acid of | ||
| label |
methacrylic acid |
|
| prefixIRI |
CHEBI:25219 |
|
| prefLabel |
methacrylic acid |
|
| subClassOf |
Create mapping