Preferred Name |
lysine |
|
Synonyms |
|
|
Definitions |
A diamino acid that has formula C6H14N2O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25094 |
|
alternative term |
alpha,epsilon-diaminocaproic acid InChIKey=KDXKERNSBIXSRK-UHFFFAOYSA-N NCCCCC(N)C(O)=O 2,6-diaminohexanoic acid Lysin C6H14N2O2 InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) lysine |
|
definition |
A diamino acid that has formula C6H14N2O2. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
lysine |
|
prefixIRI |
CHEBI:25094 |
|
prefLabel |
lysine |
|
subClassOf |
Create mapping