Preferred Name |
leucine |
|
Synonyms |
|
|
Definitions |
A branched chain amino acid that has formula C6H13NO2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25017 |
|
alternative term |
leucine 2-amino-4-methylpentanoic acid InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) C6H13NO2 Leucin Leuzin Hleu InChIKey=ROHFNLRQFUQHCH-UHFFFAOYSA-N CC(C)CC(N)C(O)=O |
|
definition |
A branched chain amino acid that has formula C6H13NO2. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
leucine |
|
prefixIRI |
CHEBI:25017 |
|
prefLabel |
leucine |
|
subClassOf |
Create mapping