loading...| Preferred Name |
colchicine |
|
| Synonyms |
|
|
| Definitions |
A carbotricyclic compound comprising 5,6,7,9-tetrahydrobenzo[a]heptalene having four methoxy substituents at the 1-, 2-, 3- and 10-positions as well as an oxo group at the 9-position and an acetamido group at the 7-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_23359 |
|
| alternative term |
InChIKey=IAKHMKGGTNLKSZ-UHFFFAOYSA-N N-(1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl)acetamide C22H25NO6 COc1cc2CCC(NC(C)=O)c3cc(=O)c(OC)ccc3-c2c(OC)c1OC InChI=1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24) |
|
| definition |
A carbotricyclic compound comprising 5,6,7,9-tetrahydrobenzo[a]heptalene having four methoxy substituents at the 1-, 2-, 3- and 10-positions as well as an oxo group at the 9-position and an acetamido group at the 7-position. |
|
| has role | ||
| label |
colchicine |
|
| prefixIRI |
CHEBI:23359 |
|
| prefLabel |
colchicine |
|
| subClassOf |