Jump to:
loading...| Preferred Name |
butenedioic acid |
|
| Synonyms |
|
|
| Definitions |
A dicarboxylic acid that has formula C4H4O4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_22958 |
|
| alternative term |
2-butenedioic acid but-2-enedioic acid C4H4O4 [H]C(=C([H])C(O)=O)C(O)=O InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8) InChIKey=VZCYOOQTPOCHFL-UHFFFAOYSA-N |
|
| definition |
A dicarboxylic acid that has formula C4H4O4. |
|
| is conjugate acid of | ||
| label |
butenedioic acid |
|
| prefixIRI |
CHEBI:22958 |
|
| prefLabel |
butenedioic acid |
|
| subClassOf |
Create mapping