Jump to:
loading...| Preferred Name |
acrylic acid |
|
| Synonyms |
|
|
| Definitions |
A monocarboxylic acid that has formula C3H4O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18308 |
|
| alternative term |
Propenoic acid prop-2-enoic acid Propenoate InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) 2-Propenoic acid ACRYLIC ACID acroleic acid Acrylic acid ethylenecarboxylic acid Vinylformic acid C3H4O2 Acrylate InChIKey=NIXOWILDQLNWCW-UHFFFAOYSA-N OC(=O)C=C |
|
| definition |
A monocarboxylic acid that has formula C3H4O2. |
|
| is conjugate acid of | ||
| label |
acrylic acid |
|
| prefixIRI |
CHEBI:18308 |
|
| prefLabel |
acrylic acid |
|
| subClassOf |
Create mapping