Preferred Name |
citrulline |
|
Synonyms |
|
|
Definitions |
The parent compound of the citrulline class consisting of ornithine having a carbamoyl group at the N(5)-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18211 |
|
alternative term |
N(5)-carbamoylornithine dl-citrulline InChIKey=RHGKLRLOHDJJDR-UHFFFAOYSA-N C6H13N3O3 2-amino-5-(carbamoylamino)pentanoic acid 2-Amino-5-uredovaleric acid NC(CCCNC(N)=O)C(O)=O N(5)-(aminocarbonyl)ornithine DL-2-amino-5-ureidovaleric acid Cit N(5)-(aminocarbonyl)-DL-ornithine citrulline InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12) N(5)-carbamoyl-DL-ornithine Citrullin citrulina Citrulline |
|
definition |
The parent compound of the citrulline class consisting of ornithine having a carbamoyl group at the N(5)-position. |
|
label |
citrulline |
|
prefixIRI |
CHEBI:18211 |
|
prefLabel |
citrulline |
|
subClassOf |
Create mapping