Jump to:
loading...| Preferred Name |
L-glutamine |
|
| Synonyms |
|
|
| Definitions |
An optically active form of glutamine having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18050 |
|
| alternative term |
L-2-Aminoglutaramic acid InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1 Q L-Glutamine L-glutamine L-Glutaminsaeure-5-amid L-2-aminoglutaramic acid InChIKey=ZDXPYRJPNDTMRX-VKHMYHEASA-N L-Glutamin (2S)-2,5-diamino-5-oxopentanoic acid C5H10N2O3 L-(+)-glutamine N[C@@H](CCC(N)=O)C(O)=O GLUTAMINE (2S)-2-amino-4-carbamoylbutanoic acid L-glutamic acid gamma-amide (S)-2,5-diamino-5-oxopentanoic acid |
|
| definition |
An optically active form of glutamine having L-configuration. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-glutamine |
|
| prefixIRI |
CHEBI:18050 |
|
| prefLabel |
L-glutamine |
|
| subClassOf |
Create mapping