Preferred Name |
fumaric acid |
|
Synonyms |
|
|
Definitions |
A butenedioic acid that has formula C4H4O4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18012 |
|
alternative term |
trans-1,2-ethylenedicarboxylic acid OC(=O)C=CC(O)=O trans-Butenedioic acid (2E)-but-2-enedioic acid Fumarsaeure FUMARIC ACID InChIKey=VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ (E)-2-butenedioic acid C4H4O4 trans-but-2-enedioic acid (2E)-2-butenedioic acid |
|
definition |
A butenedioic acid that has formula C4H4O4. |
|
is conjugate acid of | ||
label |
fumaric acid |
|
prefixIRI |
CHEBI:18012 |
|
prefLabel |
fumaric acid |
|
subClassOf |
Create mapping