Preferred Name |
hydroquinone |
|
Synonyms |
|
|
Definitions |
Aromatic compound comprising benzene core carrying two hydroxy substituents para to each other. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17594 |
|
alternative term |
1,4-Benzenediol Hydroquinone Benzene-1,4-diol 4-Hydroxyphenol InChIKey=QIGBRXMKCJKVMJ-UHFFFAOYSA-N C6H6O2 p-hydroxyphenol Eldoquin 1,4-Dihydroxybenzene p-Benzenediol Quinol benzene-1,4-diol InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H Oc1ccc(O)cc1 |
|
definition |
Aromatic compound comprising benzene core carrying two hydroxy substituents para to each other. |
|
label |
hydroquinone |
|
prefixIRI |
CHEBI:17594 |
|
prefLabel |
hydroquinone |
|
subClassOf |
Create mapping