Preferred Name |
L-cysteine |
|
Synonyms |
|
|
Definitions |
An optically active form of cysteine having L-configuration. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17561 |
|
alternative term |
L-Cysteine L-cysteine InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 FREE CYSTEINE (R)-2-amino-3-mercaptopropanoic acid CYSTEINE C N[C@@H](CS)C(O)=O L-Zystein L-2-Amino-3-mercaptopropionic acid (2R)-2-amino-3-mercaptopropanoic acid L-Cystein C3H7NO2S (2R)-2-amino-3-sulfanylpropanoic acid Cys InChIKey=XUJNEKJLAYXESH-REOHCLBHSA-N |
|
definition |
An optically active form of cysteine having L-configuration. |
|
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
is tautomer of | ||
label |
L-cysteine |
|
prefixIRI |
CHEBI:17561 |
|
prefLabel |
L-cysteine |
|
subClassOf |
Create mapping