Preferred Name |
beta-alanine |
|
Synonyms |
|
|
Definitions |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16958 |
|
alternative term |
beta-aminopropionic acid beta-alanine omega-aminopropionic acid BETA-ALANINE 3-aminopropanoic acid 3-Aminopropionic acid NCCC(O)=O InChIKey=UCMIRNVEIXFBKS-UHFFFAOYSA-N 3-Aminopropanoate beta-Alanine C3H7NO2 InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
|
definition |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
has role | ||
is tautomer of | ||
label |
beta-alanine |
|
prefixIRI |
CHEBI:16958 |
|
prefLabel |
beta-alanine |
|
subClassOf |
Create mapping