loading...| Preferred Name |
atropine |
|
| Synonyms |
|
|
| Definitions |
A tropane alkaloid obtained from deadly nightshade (Atropa belladonna) and other plants of the family Solanaceae. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16684 |
|
| alternative term |
InChIKey=RKUNBYITZUJHSG-SPUOUPEWSA-N Atropine 8-methyl-8-azabicyclo[3.2.1]oct-3-yl tropate (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 3-hydroxy-2-phenylpropanoate InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15+,16? (+-)-hyoscyamine dl-tropyltropate dl-Hyoscyamine (+,-)-tropyl tropate C17H23NO3 tropan-3alpha-yl 3-hydroxy-2-phenylpropanoate (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl tropate 8-methyl-8-azabicyclo[3.2.1]oct-3-yl 3-hydroxy-2-phenylpropanoate (+-)-atropine atropina CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)c1ccccc1 [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 3-hydroxy-2-phenyl-propanoate Atropin tropine tropate |
|
| definition |
A tropane alkaloid obtained from deadly nightshade (Atropa belladonna) and other plants of the family Solanaceae. |
|
| has functional parent | ||
| has role | ||
| is conjugate base of | ||
| label |
atropine |
|
| prefixIRI |
CHEBI:16684 |
|
| prefLabel |
atropine |
|
| subClassOf |