Preferred Name |
1,4-benzoquinone |
|
Synonyms |
|
|
Definitions |
Aromatic compound comprising benzene core carrying two ketone substituents para to each other. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16509 |
|
alternative term |
1,4-benzoquinone Quinone O=C1C=CC(=O)C=C1 InChI=1S/C6H4O2/c7-5-1-2-6(8)4-3-5/h1-4H 2,5-Cyclohexadiene-1,4-dione benzoquinone p-Chinon InChIKey=AZQWKYJCGOJGHM-UHFFFAOYSA-N p-Benzoquinone C6H4O2 cyclohexa-2,5-diene-1,4-dione benzo-1,4-quinone 1,4-Benzochinon |
|
definition |
Aromatic compound comprising benzene core carrying two ketone substituents para to each other. |
|
label |
1,4-benzoquinone |
|
prefixIRI |
CHEBI:16509 |
|
prefLabel |
1,4-benzoquinone |
|
subClassOf |
Create mapping