Preferred Name |
L-arginine |
|
Synonyms |
|
|
Definitions |
An L-alpha-amino acid; the L-isomer of arginine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16467 |
|
alternative term |
Arg (S)-2-Amino-5-guanidinovaleric acid L-arginine L-Arginin L-Arginine (S)-2-amino-5-guanidinopentanoic acid L-(+)-arginine InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 (2S)-2-amino-5-guanidinopentanoic acid InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-N C6H14N4O2 (2S)-2-amino-5-(carbamimidamido)pentanoic acid R N[C@@H](CCCNC(N)=N)C(O)=O |
|
definition |
An L-alpha-amino acid; the L-isomer of arginine. |
|
is conjugate acid of | ||
is conjugate base of | ||
is enantiomer of | ||
label |
L-arginine |
|
prefixIRI |
CHEBI:16467 |
|
prefLabel |
L-arginine |
|
subClassOf |
Create mapping