Preferred Name |
alanine |
|
Synonyms |
|
|
Definitions |
An alpha-amino acid that has formula C3H7NO2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16449 |
|
alternative term |
alanine Alanin 2-Aminopropanoic acid 2-aminopropanoic acid alanina 2-Aminopropionic acid Alanine InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) InChIKey=QNAYBMKLOCPYGJ-UHFFFAOYSA-N C3H7NO2 CC(N)C(O)=O |
|
definition |
An alpha-amino acid that has formula C3H7NO2. |
|
has functional parent | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
alanine |
|
prefixIRI |
CHEBI:16449 |
|
prefLabel |
alanine |
|
subClassOf |
Create mapping