Jump to:
loading...| Preferred Name |
quercetin |
|
| Synonyms |
|
|
| Definitions |
A pentahydroxyflavone having the five hydroxy groups placed at the 3-, 3'-, 4'-, 5- and 7-positions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16243 |
|
| alternative term |
Oc1cc(O)c2c(c1)oc(-c1ccc(O)c(O)c1)c(O)c2=O Quercetin 3,5,7,3',4'-PENTAHYDROXYFLAVONE 3,5,7,3',4'-Pentahydroxyflavone InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-N C15H10O7 |
|
| definition |
A pentahydroxyflavone having the five hydroxy groups placed at the 3-, 3'-, 4'-, 5- and 7-positions. |
|
| is conjugate acid of | ||
| label |
quercetin |
|
| prefixIRI |
CHEBI:16243 |
|
| prefLabel |
quercetin |
|
| subClassOf |
Create mapping