Jump to:
loading...| Preferred Name |
L-histidine |
|
| Synonyms |
|
|
| Definitions |
The L-enantiomer of the amino acid histidine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15971 |
|
| alternative term |
InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 L-Histidin L-Histidine N[C@@H](Cc1c[nH]cn1)C(O)=O L-histidine (S)-alpha-amino-1H-Imidazole-4-propanoic acid HISTIDINE (S)-alpha-Amino-1H-imidazole-4-propionic acid C6H9N3O2 L-(-)-histidine InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N (2S)-2-amino-3-(1H-imidazol-4-yl)propanoic acid |
|
| definition |
The L-enantiomer of the amino acid histidine. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-histidine |
|
| prefixIRI |
CHEBI:15971 |
|
| prefLabel |
L-histidine |
|
| subClassOf |
Create mapping