Preferred Name |
arachidonic acid |
|
Synonyms |
|
|
Definitions |
A C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15843 |
|
alternative term |
cis-5,8,11,14-Eicosatetraenoic acid (5Z,8Z,11Z,14Z)-5,8,11,14-icosatetraenoic acid AA ARACHIDONIC ACID all-cis-5,8,11,14-eicosatetraenoic acid InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-15- Arachidonsaeure (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid C20H32O2 Arachidonic acid cis-Delta(5,8,11,14)-eicosatetraenoic acid ARA InChIKey=YZXBAPSDXZZRGB-DOFZRALJSA-N (5Z,8Z,11Z,14Z)-Icosatetraenoic acid CCCCCC=C/CC=C/CC=C/CC=C/CCCC(O)=O |
|
definition |
A C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. |
|
has parent hydride | ||
is conjugate acid of | ||
label |
arachidonic acid |
|
prefixIRI |
CHEBI:15843 |
|
prefLabel |
arachidonic acid |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23899 http://purl.obolibrary.org/obo/CHEBI_36306 |