Preferred Name |
sarcosine |
|
Synonyms |
|
|
Definitions |
The N-methyl derivative of glycine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15611 |
|
alternative term |
Sarcosine methylaminoacetic acid N-methylaminoacetic acid sarcosinic acid (methylamino)acetic acid (methylamino)ethanoic acid sarcosine N-Methylglycine SARCOSINE Sar C3H7NO2 InChIKey=FSYKKLYZXJSNPZ-UHFFFAOYSA-N InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) CNCC(O)=O |
|
definition |
The N-methyl derivative of glycine. |
|
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
sarcosine |
|
prefixIRI |
CHEBI:15611 |
|
prefLabel |
sarcosine |
|
subClassOf |
Create mapping