Preferred Name |
glycine |
|
Synonyms |
|
|
Definitions |
The simplest (and the only achiral) proteinogenic amino acid, with a hydrogen atom as its side chain. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15428 |
|
alternative term |
InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) Aminoacetic acid Glycin H2N-CH2-COOH Gly glycine Glykokoll G NCC(O)=O aminoacetic acid InChIKey=DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Glycocoll C2H5NO2 Aminoessigsaeure Leimzucker Glyzin Hgly aminoethanoic acid GLYCINE |
|
definition |
The simplest (and the only achiral) proteinogenic amino acid, with a hydrogen atom as its side chain. |
|
has role | ||
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
glycine |
|
prefixIRI |
CHEBI:15428 |
|
prefLabel |
glycine |
|
subClassOf |
Create mapping