Jump to:
loading...| Preferred Name |
limonene |
|
| Synonyms |
|
|
| Definitions |
A monoterpene that has formula C10H16. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15384 |
|
| alternative term |
CC(=C)C1CCC(C)=CC1 InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 dl-Limonene 1,8-p-menthadiene (+-)-(RS)-limonene 4-isopropenyl-1-methylcyclohexene (+/-)-limonene Cajeputene Kautschin Limonene InChIKey=XMGQYMWWDOXHJM-UHFFFAOYSA-N 1-methyl-4-(1-methylethenyl)cyclohexene C10H16 1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene Dipentene limonene p-mentha-1,8-diene |
|
| definition |
A monoterpene that has formula C10H16. |
|
| has parent hydride | ||
| label |
limonene |
|
| prefixIRI |
CHEBI:15384 |
|
| prefLabel |
limonene |
|
| subClassOf |
Create mapping