Preferred Name |
pyruvate |
|
Synonyms |
|
|
Definitions |
A 2-oxo monocarboxylic acid anion that has formula C3H3O3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15361 |
|
alternative term |
C3H3O3 2-oxopropanoic acid, ion(1-) 2-oxopropanoate InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1 CC(=O)C([O-])=O InChIKey=LCTONWCANYUPML-UHFFFAOYSA-M |
|
definition |
A 2-oxo monocarboxylic acid anion that has formula C3H3O3. |
|
has functional parent | ||
is conjugate base of | ||
label |
pyruvate |
|
prefixIRI |
CHEBI:15361 |
|
prefLabel |
pyruvate |
|
subClassOf |
Create mapping