Preferred Name |
cysteine |
|
Synonyms |
|
|
Definitions |
A sulfur-containing amino acid that has formula C3H7NO2S. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15356 |
|
alternative term |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) Zystein 2-amino-3-mercaptopropanoic acid cysteine Hcys 2-amino-3-sulfanylpropanoic acid Cysteine InChIKey=XUJNEKJLAYXESH-UHFFFAOYSA-N NC(CS)C(O)=O Cystein cisteina C3H7NO2S 2-Amino-3-mercaptopropionic acid |
|
definition |
A sulfur-containing amino acid that has formula C3H7NO2S. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
cysteine |
|
prefixIRI |
CHEBI:15356 |
|
prefLabel |
cysteine |
|
subClassOf |
Create mapping