Preferred Name |
benzocaine |
|
Synonyms |
|
|
Definitions |
A benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_116735 |
|
alternative term |
4-aminobenzoic acid ethyl ester C9H11NO2 Ethyl aminobenzoate p-Carbethoxyaniline InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 CCOC(=O)c1ccc(N)cc1 p-Ethoxycarboxylic aniline Benzocaine InChIKey=BLFLLBZGZJTVJG-UHFFFAOYSA-N Ethyl p-aminophenylcarboxylate Benzocaina ethyl 4-aminobenzoate Amben ethyl ester p-(Ethoxycarbonyl)aniline Benzocainum Ethyl p-aminobenzoate |
|
definition |
A benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina. |
|
has role | ||
label |
benzocaine |
|
prefixIRI |
CHEBI:116735 |
|
prefLabel |
benzocaine |
|
subClassOf |