Preferred Name |
gemifloxacin |
|
Synonyms |
|
|
Definitions |
A 1,4-dihydro-1,8-naphthyridine with a carboxy group at the 3-position, an oxo sustituent at the 4-position, a fluoro substituent at the 5-position and a substituted pyrrolin-1-yl group at the 7-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_101853 |
|
alternative term |
InChIKey=ZRCVYEYHRGVLOC-HYARGMPZSA-N InChI=1S/C18H20FN5O4/c1-28-22-14-8-23(6-9(14)5-20)17-13(19)4-11-15(25)12(18(26)27)7-24(10-2-3-10)16(11)21-17/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,26,27)/b22-14+ 7-[3-(aminomethyl)-4-(methoxyimino)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid CON=C1/CN(CC1CN)c1nc2n(cc(C(O)=O)c(=O)c2cc1F)C1CC1 gemifloxacin |
|
definition |
A 1,4-dihydro-1,8-naphthyridine with a carboxy group at the 3-position, an oxo sustituent at the 4-position, a fluoro substituent at the 5-position and a substituted pyrrolin-1-yl group at the 7-position. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_22582 |
|
label |
gemifloxacin |
|
prefixIRI |
CHEBI:101853 |
|
prefLabel |
gemifloxacin |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37143 |